C21H25FN2 — CID 146630150
(E)-2-[4-(2-aminoethyl)-3-fluorophenyl]-N-ethenyl-1-(4-ethylphenyl)prop-1-en-1-amine (PubChem CID 146630150) has the molecular formula C21H25FN2 and a molecular weight of 324.44 g/mol. Its IUPAC name is (E)-2-[4-(2-aminoethyl)-3-fluorophenyl]-N-ethenyl-1-(4-ethylphenyl)prop-1-en-1-amine.
| Compound Name | (E)-2-[4-(2-aminoethyl)-3-fluorophenyl]-N-ethenyl-1-(4-ethylphenyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 146630150 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (E)-2-[4-(2-aminoethyl)-3-fluorophenyl]-N-ethenyl-1-(4-ethylphenyl)prop-1-en-1-amine |
| SMILES | C=CN/C(=C(\C)c1ccc(CCN)c(F)c1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H25FN2/c1-4-16-6-8-18(9-7-16)21(24-5-2)15(3)19-11-10-17(12-13-23)20(22)14-19/h5-11,14,24H,2,4,12-13,23H2,1,3H3/b21-15+ |
| InChIKey | XEXWEHNQCZVQMM-RCCKNPSSSA-N |
| XLogP | 4.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|