C15H18FN — CID 170599811
(3E)-N-ethenyl-3-(4-ethylphenyl)-4-fluoropenta-1,3-dien-2-amine (PubChem CID 170599811) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is (3E)-N-ethenyl-3-(4-ethylphenyl)-4-fluoropenta-1,3-dien-2-amine.
| Compound Name | (3E)-N-ethenyl-3-(4-ethylphenyl)-4-fluoropenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 170599811 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (3E)-N-ethenyl-3-(4-ethylphenyl)-4-fluoropenta-1,3-dien-2-amine |
| SMILES | C=CNC(=C)/C(=C(\C)F)c1ccc(CC)cc1 |
| InChI | InChI=1S/C15H18FN/c1-5-13-7-9-14(10-8-13)15(11(3)16)12(4)17-6-2/h6-10,17H,2,4-5H2,1,3H3/b15-11- |
| InChIKey | BBLRJHCOEZRNII-PTNGSMBKSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|