C35H49N3 — CID 138463246
N'-[2-[4-[[[(E)-1,2-bis(3,4-diethylphenyl)prop-1-enyl]amino]methyl]phenyl]ethyl]propane-1,3-diamine (PubChem CID 138463246) has the molecular formula C35H49N3 and a molecular weight of 511.80 g/mol. Its IUPAC name is N'-[2-[4-[[[(E)-1,2-bis(3,4-diethylphenyl)prop-1-enyl]amino]methyl]phenyl]ethyl]propane-1,3-diamine.
| Compound Name | N'-[2-[4-[[[(E)-1,2-bis(3,4-diethylphenyl)prop-1-enyl]amino]methyl]phenyl]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 138463246 |
| Molecular Formula | C35H49N3 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | N'-[2-[4-[[[(E)-1,2-bis(3,4-diethylphenyl)prop-1-enyl]amino]methyl]phenyl]ethyl]propane-1,3-diamine |
| SMILES | CCc1ccc(/C(C)=C(/NCc2ccc(CCNCCCN)cc2)c2ccc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C35H49N3/c1-6-29-15-17-33(23-31(29)8-3)26(5)35(34-18-16-30(7-2)32(9-4)24-34)38-25-28-13-11-27(12-14-28)19-22-37-21-10-20-36/h11-18,23-24,37-38H,6-10,19-22,25,36H2,1-5H3/b35-26+ |
| InChIKey | BPOWPUBXNYTTOL-MDAYZVFASA-N |
| XLogP | 7.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|