C11H12N2O — CID 14663052
4-oxido-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinazolin-4-ium (PubChem CID 14663052) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-oxido-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinazolin-4-ium.
| Compound Name | 4-oxido-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinazolin-4-ium |
|---|---|
| PubChem CID | 14663052 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-oxido-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinazolin-4-ium |
| SMILES | [O-][N+]1=Cc2ccccc2N2CCCC21 |
| InChI | InChI=1S/C11H12N2O/c14-13-8-9-4-1-2-5-10(9)12-7-3-6-11(12)13/h1-2,4-5,8,11H,3,6-7H2 |
| InChIKey | BCOIIJQMFZCDBN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|