C11H12ClN3 — CID 18992332
4-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazolin-9-imine (PubChem CID 18992332) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 4-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazolin-9-imine.
| Compound Name | 4-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazolin-9-imine |
|---|---|
| PubChem CID | 18992332 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazolin-9-imine |
| SMILES | [H]/N=C1\c2ccccc2N(Cl)C2CCCN12 |
| InChI | InChI=1S/C11H12ClN3/c12-15-9-5-2-1-4-8(9)11(13)14-7-3-6-10(14)15/h1-2,4-5,10,13H,3,6-7H2/b13-11+ |
| InChIKey | WSOCUMSLTCOJFG-ACCUITESSA-N |
| XLogP | 2.41 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|