C16H20N4O — CID 136678665
(8S)-2-(1,3-dimethyl-2H-benzimidazol-2-yl)-3-imino-5,6,7,8-tetrahydropyrrolizin-1-ol (PubChem CID 136678665) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (8S)-2-(1,3-dimethyl-2H-benzimidazol-2-yl)-3-imino-5,6,7,8-tetrahydropyrrolizin-1-ol.
| Compound Name | (8S)-2-(1,3-dimethyl-2H-benzimidazol-2-yl)-3-imino-5,6,7,8-tetrahydropyrrolizin-1-ol |
|---|---|
| PubChem CID | 136678665 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (8S)-2-(1,3-dimethyl-2H-benzimidazol-2-yl)-3-imino-5,6,7,8-tetrahydropyrrolizin-1-ol |
| SMILES | [H]/N=C1/C(C2N(C)c3ccccc3N2C)=C(O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C16H20N4O/c1-18-10-6-3-4-7-11(10)19(2)16(18)13-14(21)12-8-5-9-20(12)15(13)17/h3-4,6-7,12,16-17,21H,5,8-9H2,1-2H3/b17-15-/t12-/m0/s1 |
| InChIKey | TUJZOEGEYDEUPC-JTFSYWPOSA-N |
| XLogP | 2.17 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|