C24H37NO3 — CID 146630995
cyclodecyl (3R)-3-benzyl-4-oxo-4-(propylamino)butanoate (PubChem CID 146630995) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is cyclodecyl (3R)-3-benzyl-4-oxo-4-(propylamino)butanoate.
| Compound Name | cyclodecyl (3R)-3-benzyl-4-oxo-4-(propylamino)butanoate |
|---|---|
| PubChem CID | 146630995 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | cyclodecyl (3R)-3-benzyl-4-oxo-4-(propylamino)butanoate |
| SMILES | CCCNC(=O)[C@@H](CC(=O)OC1CCCCCCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO3/c1-2-17-25-24(27)21(18-20-13-9-8-10-14-20)19-23(26)28-22-15-11-6-4-3-5-7-12-16-22/h8-10,13-14,21-22H,2-7,11-12,15-19H2,1H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | DNCMKCTUGVEWPG-OAQYLSRUSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |