C19H24N2O2 — CID 146634697
1-[4-[(2-aminoanilino)-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one (PubChem CID 146634697) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[4-[(2-aminoanilino)-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-[(2-aminoanilino)-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 146634697 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[4-[(2-aminoanilino)-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1ccc(C(O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-19(2,3)12-17(22)13-8-10-14(11-9-13)18(23)21-16-7-5-4-6-15(16)20/h4-11,18,21,23H,12,20H2,1-3H3 |
| InChIKey | RQULLHWKIATJKQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|