About 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one
1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one (PubChem CID 58053064) has the molecular formula C25H32O3
and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one |
| PubChem CID | 58053064 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1ccc(C(O)c2ccc(C(=O)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H32O3/c1-24(2,3)15-21(26)17-7-11-19(12-8-17)23(28)20-13-9-18(10-14-20)22(27)16-25(4,5)6/h7-14,23,28H,15-16H2,1-6H3 |
| InChIKey | YOBLZASJTTTYIQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one?
The IUPAC name of 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one (CID 58053064) is 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one is CC(C)(C)CC(=O)c1ccc(C(O)c2ccc(C(=O)CC(C)(C)C)cc2)cc1.
What is the InChIKey of 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one?
The InChIKey is YOBLZASJTTTYIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O3/c1-24(2,3)15-21(26)17-7-11-19(12-8-17)23(28)20-13-9-18(10-14-20)22(27)16-25(4,5)6/h7-14,23,28H,15-16H2,1-6H3.
What are the key properties of 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one?
1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one has a molecular weight of 380.53 g/mol, XLogP of 6.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(3,3-dimethylbutanoyl)phenyl]-hydroxymethyl]phenyl]-3,3-dimethylbutan-1-one is sourced from PubChem (CID 58053064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).