C12H9O22P — CID 146635454
bis(tricarboxymethoxy)phosphoryloxymethanetricarboxylic acid (PubChem CID 146635454) has the molecular formula C12H9O22P and a molecular weight of 536.16 g/mol. Its IUPAC name is bis(tricarboxymethoxy)phosphoryloxymethanetricarboxylic acid.
| Compound Name | bis(tricarboxymethoxy)phosphoryloxymethanetricarboxylic acid |
|---|---|
| PubChem CID | 146635454 |
| Molecular Formula | C12H9O22P |
| Molecular Weight | 536.16 g/mol |
| Exact Mass | 535.93 |
| IUPAC Name | bis(tricarboxymethoxy)phosphoryloxymethanetricarboxylic acid |
| SMILES | O=C(O)C(OP(=O)(OC(C(=O)O)(C(=O)O)C(=O)O)OC(C(=O)O)(C(=O)O)C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H9O22P/c13-1(14)10(2(15)16,3(17)18)32-35(31,33-11(4(19)20,5(21)22)6(23)24)34-12(7(25)26,8(27)28)9(29)30/h(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | LAXDUTMVLFMHAQ-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 380.46 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.16 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|