C9H4F6LiO13P — CID 174143699
lithium;3-bis[(2-carboxy-2,2-difluoroacetyl)oxy]phosphoryloxy-2,2-difluoro-3-oxopropanoic acid;hydride (PubChem CID 174143699) has the molecular formula C9H4F6LiO13P and a molecular weight of 472.02 g/mol. Its IUPAC name is lithium;3-bis[(2-carboxy-2,2-difluoroacetyl)oxy]phosphoryloxy-2,2-difluoro-3-oxopropanoic acid;hydride.
| Compound Name | lithium;3-bis[(2-carboxy-2,2-difluoroacetyl)oxy]phosphoryloxy-2,2-difluoro-3-oxopropanoic acid;hydride |
|---|---|
| PubChem CID | 174143699 |
| Molecular Formula | C9H4F6LiO13P |
| Molecular Weight | 472.02 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | lithium;3-bis[(2-carboxy-2,2-difluoroacetyl)oxy]phosphoryloxy-2,2-difluoro-3-oxopropanoic acid;hydride |
| SMILES | O=C(O)C(F)(F)C(=O)OP(=O)(OC(=O)C(F)(F)C(=O)O)OC(=O)C(F)(F)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C9H3F6O13P.Li.H/c10-7(11,1(16)17)4(22)26-29(25,27-5(23)8(12,13)2(18)19)28-6(24)9(14,15)3(20)21;;/h(H,16,17)(H,18,19)(H,20,21);;/q;+1;-1 |
| InChIKey | HNIDKKNNKQWCIV-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 207.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.02 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|