C11H16ClN3O4S — CID 146636294
6-chloro-4-methoxy-3-(1-methylsulfonylpiperidin-4-yl)oxypyridazine (PubChem CID 146636294) has the molecular formula C11H16ClN3O4S and a molecular weight of 321.79 g/mol. Its IUPAC name is 6-chloro-4-methoxy-3-(1-methylsulfonylpiperidin-4-yl)oxypyridazine.
| Compound Name | 6-chloro-4-methoxy-3-(1-methylsulfonylpiperidin-4-yl)oxypyridazine |
|---|---|
| PubChem CID | 146636294 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 6-chloro-4-methoxy-3-(1-methylsulfonylpiperidin-4-yl)oxypyridazine |
| SMILES | COc1cc(Cl)nnc1OC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H16ClN3O4S/c1-18-9-7-10(12)13-14-11(9)19-8-3-5-15(6-4-8)20(2,16)17/h7-8H,3-6H2,1-2H3 |
| InChIKey | UJMFVPAIJFBXNG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |