C27H31BrF2O8 — CID 146636392
[2-[(6R,8S,9R,10S,11S,13S,14S,17R)-11,17-diacetyloxy-2-bromo-6,9-difluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 146636392) has the molecular formula C27H31BrF2O8 and a molecular weight of 601.44 g/mol. Its IUPAC name is [2-[(6R,8S,9R,10S,11S,13S,14S,17R)-11,17-diacetyloxy-2-bromo-6,9-difluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(6R,8S,9R,10S,11S,13S,14S,17R)-11,17-diacetyloxy-2-bromo-6,9-difluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 146636392 |
| Molecular Formula | C27H31BrF2O8 |
| Molecular Weight | 601.44 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | [2-[(6R,8S,9R,10S,11S,13S,14S,17R)-11,17-diacetyloxy-2-bromo-6,9-difluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(C)=O)CC[C@H]2[C@@H]3C[C@@H](F)C4=CC(=O)C(Br)=C[C@]4(C)[C@@]3(F)[C@@H](OC(C)=O)C[C@@]21C |
| InChI | InChI=1S/C27H31BrF2O8/c1-13(31)36-12-22(35)26(38-15(3)33)7-6-16-17-8-20(29)18-9-21(34)19(28)10-25(18,5)27(17,30)23(37-14(2)32)11-24(16,26)4/h9-10,16-17,20,23H,6-8,11-12H2,1-5H3/t16-,17-,20+,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | NDULVWUUDLJJEO-FEIQQFMTSA-N |
| XLogP | 4.03 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|