C23H26Cl2F2O6 — CID 18394616
methyl (6S,8S,9R,10S,11S,13S,14S,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18394616) has the molecular formula C23H26Cl2F2O6 and a molecular weight of 507.36 g/mol. Its IUPAC name is methyl (6S,8S,9R,10S,11S,13S,14S,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (6S,8S,9R,10S,11S,13S,14S,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18394616 |
| Molecular Formula | C23H26Cl2F2O6 |
| Molecular Weight | 507.36 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | methyl (6S,8S,9R,10S,11S,13S,14S,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@@]1(OC(=O)C(Cl)Cl)CC[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H26Cl2F2O6/c1-20-6-4-11(28)8-14(20)15(26)9-13-12-5-7-22(19(31)32-3,33-18(30)17(24)25)21(12,2)10-16(29)23(13,20)27/h4,6,8,12-13,15-17,29H,5,7,9-10H2,1-3H3/t12-,13-,15-,16-,20-,21-,22-,23-/m0/s1 |
| InChIKey | ZKLXHGAUOMMXIS-MTQMLDOVSA-N |
| XLogP | 3.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|