C19H17F4N3O2 — CID 146643011
N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3-fluoro-4-(trifluoromethoxy)benzamide (PubChem CID 146643011) has the molecular formula C19H17F4N3O2 and a molecular weight of 395.36 g/mol. Its IUPAC name is N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3-fluoro-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3-fluoro-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 146643011 |
| Molecular Formula | C19H17F4N3O2 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3-fluoro-4-(trifluoromethoxy)benzamide |
| SMILES | [H]/N=C/c1c(N)ccc(C2CC2)c1CNC(=O)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C19H17F4N3O2/c20-15-7-11(3-6-17(15)28-19(21,22)23)18(27)26-9-14-12(10-1-2-10)4-5-16(25)13(14)8-24/h3-8,10,24H,1-2,9,25H2,(H,26,27)/b24-8+ |
| InChIKey | VXKILUMRCPODQA-KTZMUZOWSA-N |
| XLogP | 4.11 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|