C17H20FN5O2 — CID 146643951
N-[(3-amino-6-cyclopropyl-2-hydrazinylphenyl)methyl]-5-fluoro-6-methoxypyridine-3-carboxamide (PubChem CID 146643951) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[(3-amino-6-cyclopropyl-2-hydrazinylphenyl)methyl]-5-fluoro-6-methoxypyridine-3-carboxamide.
| Compound Name | N-[(3-amino-6-cyclopropyl-2-hydrazinylphenyl)methyl]-5-fluoro-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 146643951 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(3-amino-6-cyclopropyl-2-hydrazinylphenyl)methyl]-5-fluoro-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(C(=O)NCc2c(C3CC3)ccc(N)c2NN)cc1F |
| InChI | InChI=1S/C17H20FN5O2/c1-25-17-13(18)6-10(7-22-17)16(24)21-8-12-11(9-2-3-9)4-5-14(19)15(12)23-20/h4-7,9,23H,2-3,8,19-20H2,1H3,(H,21,24) |
| InChIKey | RZTYVQCCAJUAME-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|