About 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate
2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate (PubChem CID 87194470) has the molecular formula C12H14FNO5
and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate |
| PubChem CID | 87194470 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate |
| SMILES | COc1ncc(C(=O)OC(=O)OCC(C)C)cc1F |
| InChI | InChI=1S/C12H14FNO5/c1-7(2)6-18-12(16)19-11(15)8-4-9(13)10(17-3)14-5-8/h4-5,7H,6H2,1-3H3 |
| InChIKey | WBCZMCSFGOIOPU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate?
The IUPAC name of 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate (CID 87194470) is 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate.
What is the SMILES notation for 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate?
The canonical SMILES for 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate is COc1ncc(C(=O)OC(=O)OCC(C)C)cc1F.
What is the InChIKey of 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate?
The InChIKey is WBCZMCSFGOIOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO5/c1-7(2)6-18-12(16)19-11(15)8-4-9(13)10(17-3)14-5-8/h4-5,7H,6H2,1-3H3.
What are the key properties of 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate?
2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate has a molecular weight of 271.24 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropoxycarbonyl 5-fluoro-6-methoxypyridine-3-carboxylate is sourced from PubChem (CID 87194470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).