C10H13NO6 — CID 10586291
2-methylpropoxycarbonyl 3-methoxy-1,2-oxazole-5-carboxylate (PubChem CID 10586291) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl 3-methoxy-1,2-oxazole-5-carboxylate.
| Compound Name | 2-methylpropoxycarbonyl 3-methoxy-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 10586291 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-methylpropoxycarbonyl 3-methoxy-1,2-oxazole-5-carboxylate |
| SMILES | COc1cc(C(=O)OC(=O)OCC(C)C)on1 |
| InChI | InChI=1S/C10H13NO6/c1-6(2)5-15-10(13)16-9(12)7-4-8(14-3)11-17-7/h4,6H,5H2,1-3H3 |
| InChIKey | DBBAZCXSLYOUNI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|