About methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate
methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate (PubChem CID 90880259) has the molecular formula C9H11NO6
and a molecular weight of 229.19 g/mol. Its IUPAC name is methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate.
Analyze methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate (CID 90880259) is methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate is CCC(O)C(=O)Oc1cc(C(=O)OC)on1.
What is the InChIKey of methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate?
The InChIKey is YCYQCPPKCUVGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO6/c1-3-5(11)8(12)15-7-4-6(16-10-7)9(13)14-2/h4-5,11H,3H2,1-2H3.
What are the key properties of methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate?
methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate has a molecular weight of 229.19 g/mol, XLogP of 0.14, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-hydroxybutanoyloxy)-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 90880259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).