C22H18F3NO2S — CID 146643637
1-[1-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]-4-sulfanylpyrrol-2-yl]propan-1-one (PubChem CID 146643637) has the molecular formula C22H18F3NO2S and a molecular weight of 417.45 g/mol. Its IUPAC name is 1-[1-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]-4-sulfanylpyrrol-2-yl]propan-1-one.
| Compound Name | 1-[1-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]-4-sulfanylpyrrol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 146643637 |
| Molecular Formula | C22H18F3NO2S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-[1-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]-4-sulfanylpyrrol-2-yl]propan-1-one |
| SMILES | CCC(=O)c1cc(S)cn1CC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H18F3NO2S/c1-2-20(27)19-11-18(29)12-26(19)13-21(28)15-8-6-14(7-9-15)16-4-3-5-17(10-16)22(23,24)25/h3-12,29H,2,13H2,1H3 |
| InChIKey | LSBUOEPZYASCAW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|