C27H33N7O3 — CID 146646289
1-[(2S,4R)-2-[(3E,5Z)-4-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]hepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidin-1-yl]ethanone (PubChem CID 146646289) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[(3E,5Z)-4-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]hepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S,4R)-2-[(3E,5Z)-4-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]hepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 146646289 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 1-[(2S,4R)-2-[(3E,5Z)-4-[4-amino-5-[2-(oxan-4-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]hepta-1,3,5-trien-2-yl]-4-hydroxypyrrolidin-1-yl]ethanone |
| SMILES | C=C(/C=C(\C=C/C)c1cc(-c2ccnn2C2CCOCC2)c2c(N)ncnn12)[C@@H]1C[C@@H](O)CN1C(C)=O |
| InChI | InChI=1S/C27H33N7O3/c1-4-5-19(12-17(2)24-13-21(36)15-32(24)18(3)35)25-14-22(26-27(28)29-16-31-34(25)26)23-6-9-30-33(23)20-7-10-37-11-8-20/h4-6,9,12,14,16,20-21,24,36H,2,7-8,10-11,13,15H2,1,3H3,(H2,28,29,31)/b5-4-,19-12+/t21-,24+/m1/s1 |
| InChIKey | JOFUWIVATAZUQZ-JPYQZMJSSA-N |
| XLogP | 3.02 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|