About N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine
N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine (PubChem CID 146646997) has the molecular formula C13H26N2S
and a molecular weight of 242.43 g/mol. Its IUPAC name is N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine.
Molecular Properties
| Compound Name | N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine |
| PubChem CID | 146646997 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine |
| SMILES | C=CCCC(NC)C(=C)SCCCCNC |
| InChI | InChI=1S/C13H26N2S/c1-5-6-9-13(15-4)12(2)16-11-8-7-10-14-3/h5,13-15H,1-2,6-11H2,3-4H3 |
| InChIKey | JAKLZCKJNCJJPD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine?
The IUPAC name of N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine (CID 146646997) is N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine.
What is the SMILES notation for N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine?
The canonical SMILES for N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine is C=CCCC(NC)C(=C)SCCCCNC.
What is the InChIKey of N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine?
The InChIKey is JAKLZCKJNCJJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2S/c1-5-6-9-13(15-4)12(2)16-11-8-7-10-14-3/h5,13-15H,1-2,6-11H2,3-4H3.
What are the key properties of N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine?
N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine has a molecular weight of 242.43 g/mol, XLogP of 2.79, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[4-(methylamino)butylsulfanyl]hepta-1,6-dien-3-amine is sourced from PubChem (CID 146646997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).