C44H46N4 — CID 146647242
2-[6-(1,2,3,9,10,10a-hexahydrophenanthren-2-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-2-yl)cyclohexen-1-yl]-1,5,6,8a-tetrahydroquinoline (PubChem CID 146647242) has the molecular formula C44H46N4 and a molecular weight of 630.88 g/mol. Its IUPAC name is 2-[6-(1,2,3,9,10,10a-hexahydrophenanthren-2-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-2-yl)cyclohexen-1-yl]-1,5,6,8a-tetrahydroquinoline.
| Compound Name | 2-[6-(1,2,3,9,10,10a-hexahydrophenanthren-2-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-2-yl)cyclohexen-1-yl]-1,5,6,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 146647242 |
| Molecular Formula | C44H46N4 |
| Molecular Weight | 630.88 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | 2-[6-(1,2,3,9,10,10a-hexahydrophenanthren-2-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-2-yl)cyclohexen-1-yl]-1,5,6,8a-tetrahydroquinoline |
| SMILES | C1=CC(C2N=C(c3ccccc3)NC(C3CC=C(C4=CC=C5CCC=CC5N4)C(C4CC=C5c6ccccc6CCC5C4)C3)=N2)=CCC1 |
| InChI | InChI=1S/C44H46N4/c1-3-13-31(14-4-1)42-46-43(32-15-5-2-6-16-32)48-44(47-42)35-22-25-38(41-26-23-30-12-8-10-18-40(30)45-41)39(28-35)34-21-24-37-33(27-34)20-19-29-11-7-9-17-36(29)37/h1,3-5,7,9-11,13-18,23-26,33-35,39-40,43,45H,2,6,8,12,19-22,27-28H2,(H,46,47,48) |
| InChIKey | XLGMBFFWDJYDAU-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.88 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|