C43H39N5 — CID 139525718
4-cyclohexa-1,3-dien-1-yl-2-[4-(6-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]-6-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 139525718) has the molecular formula C43H39N5 and a molecular weight of 625.82 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-2-[4-(6-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]-6-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-2-[4-(6-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]-6-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 139525718 |
| Molecular Formula | C43H39N5 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-2-[4-(6-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]-6-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CCCC(C2N=C(c3ccccc3)NC(C3C=CC(C4N=C(c5ccccc5)C(c5ccccc5)=C(C5C=CC=CC5)N4)=CC3)=N2)=C1 |
| InChI | InChI=1S/C43H39N5/c1-6-16-30(17-7-1)37-38(31-18-8-2-9-19-31)44-40(45-39(37)32-20-10-3-11-21-32)35-26-28-36(29-27-35)43-47-41(33-22-12-4-13-23-33)46-42(48-43)34-24-14-5-15-25-34/h1-14,16-20,22-24,26-28,32,36,40,42,45H,15,21,25,29H2,(H,46,47,48) |
| InChIKey | SZUUMUKZKSFOLL-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |