C44H46N4 — CID 155482976
2-[4-cyclohexa-2,4-dien-1-yl-6-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,4-dihydro-1,3,5-triazin-2-yl]-6b-methyl-11-phenyl-4,6a,7,11a-tetrahydro-3H-benzo[a]carbazole (PubChem CID 155482976) has the molecular formula C44H46N4 and a molecular weight of 630.88 g/mol. Its IUPAC name is 2-[4-cyclohexa-2,4-dien-1-yl-6-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,4-dihydro-1,3,5-triazin-2-yl]-6b-methyl-11-phenyl-4,6a,7,11a-tetrahydro-3H-benzo[a]carbazole.
| Compound Name | 2-[4-cyclohexa-2,4-dien-1-yl-6-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,4-dihydro-1,3,5-triazin-2-yl]-6b-methyl-11-phenyl-4,6a,7,11a-tetrahydro-3H-benzo[a]carbazole |
|---|---|
| PubChem CID | 155482976 |
| Molecular Formula | C44H46N4 |
| Molecular Weight | 630.88 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | 2-[4-cyclohexa-2,4-dien-1-yl-6-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,4-dihydro-1,3,5-triazin-2-yl]-6b-methyl-11-phenyl-4,6a,7,11a-tetrahydro-3H-benzo[a]carbazole |
| SMILES | CC12CC=CC=C1N(c1ccccc1)C1C3=C(C=CC12)CCC(C1=NC(C2C=CC=CC2)N=C(C2C=CC(C4=CC=CCC4)CC2)N1)=C3 |
| InChI | InChI=1S/C44H46N4/c1-44-28-12-11-19-39(44)48(36-17-9-4-10-18-36)40-37-29-35(25-22-32(37)26-27-38(40)44)43-46-41(33-15-7-3-8-16-33)45-42(47-43)34-23-20-31(21-24-34)30-13-5-2-6-14-30/h2-5,7-13,15,17-20,23,26-27,29,31,33-34,38,40-41H,6,14,16,21-22,24-25,28H2,1H3,(H,45,46,47) |
| InChIKey | GFHGIUAQECDNRU-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.88 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|