C42H41N3 — CID 88948411
6-(2,4b,8a,9-tetrahydro-1H-carbazol-3-yl)-N-cyclohexa-1,3-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-9-phenyl-2,3,7,8-tetrahydrocarbazol-3-amine (PubChem CID 88948411) has the molecular formula C42H41N3 and a molecular weight of 587.81 g/mol. Its IUPAC name is 6-(2,4b,8a,9-tetrahydro-1H-carbazol-3-yl)-N-cyclohexa-1,3-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-9-phenyl-2,3,7,8-tetrahydrocarbazol-3-amine.
| Compound Name | 6-(2,4b,8a,9-tetrahydro-1H-carbazol-3-yl)-N-cyclohexa-1,3-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-9-phenyl-2,3,7,8-tetrahydrocarbazol-3-amine |
|---|---|
| PubChem CID | 88948411 |
| Molecular Formula | C42H41N3 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 6-(2,4b,8a,9-tetrahydro-1H-carbazol-3-yl)-N-cyclohexa-1,3-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-9-phenyl-2,3,7,8-tetrahydrocarbazol-3-amine |
| SMILES | C1=CCCC(N(C2C=CC=CC2)C2C=c3c4c(n(-c5ccccc5)c3=CC2)CCC(C2=CC3=C(CC2)NC2C=CC=CC32)=C4)=C1 |
| InChI | InChI=1S/C42H41N3/c1-4-12-31(13-5-1)44(32-14-6-2-7-15-32)34-22-25-42-38(28-34)37-27-30(21-24-41(37)45(42)33-16-8-3-9-17-33)29-20-23-40-36(26-29)35-18-10-11-19-39(35)43-40/h1-6,8-12,14,16-19,25-28,31,34-35,39,43H,7,13,15,20-24H2 |
| InChIKey | RENCMHDMOSSION-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |