C42H36N4 — CID 139525742
4-[5-(4-cyanocyclohexa-1,3-dien-1-yl)-3-(6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-5-phenyl-1,4-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]benzonitrile (PubChem CID 139525742) has the molecular formula C42H36N4 and a molecular weight of 596.78 g/mol. Its IUPAC name is 4-[5-(4-cyanocyclohexa-1,3-dien-1-yl)-3-(6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-5-phenyl-1,4-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]benzonitrile.
| Compound Name | 4-[5-(4-cyanocyclohexa-1,3-dien-1-yl)-3-(6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-5-phenyl-1,4-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]benzonitrile |
|---|---|
| PubChem CID | 139525742 |
| Molecular Formula | C42H36N4 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | 4-[5-(4-cyanocyclohexa-1,3-dien-1-yl)-3-(6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-5-phenyl-1,4-dihydropyrimidin-2-yl)cyclohexa-2,4-dien-1-yl]benzonitrile |
| SMILES | N#CC1=CC=C(C2=CC(C3=NC(C4C=CC=CC4)C(c4ccccc4)=C(C4=CC=CCC4)N3)=CC(c3ccc(C#N)cc3)C2)CC1 |
| InChI | InChI=1S/C42H36N4/c43-27-29-16-20-31(21-17-29)36-24-37(32-22-18-30(28-44)19-23-32)26-38(25-36)42-45-40(34-12-6-2-7-13-34)39(33-10-4-1-5-11-33)41(46-42)35-14-8-3-9-15-35/h1-8,10-12,14,16-18,20-22,25-26,34,36,40H,9,13,15,19,23-24H2,(H,45,46) |
| InChIKey | CTGNVRNXDMFRNE-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |