C48H45N3 — CID 139525720
4-cyclohexa-2,4-dien-1-yl-2-[3-(5,6-dihydrophenanthren-9-yl)-5-(3-methyl-1,2,3,6-tetrahydropyridin-6-yl)cyclohexa-1,5-dien-1-yl]-5,6-diphenyl-1,4-dihydropyrimidine (PubChem CID 139525720) has the molecular formula C48H45N3 and a molecular weight of 663.91 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-2-[3-(5,6-dihydrophenanthren-9-yl)-5-(3-methyl-1,2,3,6-tetrahydropyridin-6-yl)cyclohexa-1,5-dien-1-yl]-5,6-diphenyl-1,4-dihydropyrimidine.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-2-[3-(5,6-dihydrophenanthren-9-yl)-5-(3-methyl-1,2,3,6-tetrahydropyridin-6-yl)cyclohexa-1,5-dien-1-yl]-5,6-diphenyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 139525720 |
| Molecular Formula | C48H45N3 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-2-[3-(5,6-dihydrophenanthren-9-yl)-5-(3-methyl-1,2,3,6-tetrahydropyridin-6-yl)cyclohexa-1,5-dien-1-yl]-5,6-diphenyl-1,4-dihydropyrimidine |
| SMILES | CC1C=CC(C2=CC(C3=NC(C4C=CC=CC4)C(c4ccccc4)=C(c4ccccc4)N3)=CC(c3cc4ccccc4c4c3C=CCC4)C2)NC1 |
| InChI | InChI=1S/C48H45N3/c1-32-25-26-44(49-31-32)38-27-37(43-30-36-21-11-12-22-40(36)41-23-13-14-24-42(41)43)28-39(29-38)48-50-46(34-17-7-3-8-18-34)45(33-15-5-2-6-16-33)47(51-48)35-19-9-4-10-20-35/h2-12,14-19,21-22,24-26,28-30,32,35,37,44,47,49H,13,20,23,27,31H2,1H3,(H,50,51) |
| InChIKey | VJOMGHVDSRLWKQ-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|