C45H36N4 — CID 163416400
3-methyl-6-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]-3,4,5,6-tetrahydrobenzo[j]phenanthridine (PubChem CID 163416400) has the molecular formula C45H36N4 and a molecular weight of 632.81 g/mol. Its IUPAC name is 3-methyl-6-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]-3,4,5,6-tetrahydrobenzo[j]phenanthridine.
| Compound Name | 3-methyl-6-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]-3,4,5,6-tetrahydrobenzo[j]phenanthridine |
|---|---|
| PubChem CID | 163416400 |
| Molecular Formula | C45H36N4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 3-methyl-6-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]cyclohexa-2,4-dien-1-yl]-3,4,5,6-tetrahydrobenzo[j]phenanthridine |
| SMILES | CC1C=CC2=C(C1)NC(C1C=C(c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)C=CC1)c1cc3ccccc3cc12 |
| InChI | InChI=1S/C45H36N4/c1-29-19-24-38-39-27-34-15-8-9-16-35(34)28-40(39)42(46-41(38)25-29)36-17-10-18-37(26-36)45-48-43(32-13-6-3-7-14-32)47-44(49-45)33-22-20-31(21-23-33)30-11-4-2-5-12-30/h2-16,18-24,26-29,36,42,46H,17,25H2,1H3 |
| InChIKey | AETXBCDRTZCNFD-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |