C42H40N4 — CID 130180968
(5R)-5-[3-(5,6-dihydrophenanthren-9-yl)-5-(4,6-dimethyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-2,4-diphenyl-1,2-dihydropyrrol-5-amine (PubChem CID 130180968) has the molecular formula C42H40N4 and a molecular weight of 600.81 g/mol. Its IUPAC name is (5R)-5-[3-(5,6-dihydrophenanthren-9-yl)-5-(4,6-dimethyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-2,4-diphenyl-1,2-dihydropyrrol-5-amine.
| Compound Name | (5R)-5-[3-(5,6-dihydrophenanthren-9-yl)-5-(4,6-dimethyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-2,4-diphenyl-1,2-dihydropyrrol-5-amine |
|---|---|
| PubChem CID | 130180968 |
| Molecular Formula | C42H40N4 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | (5R)-5-[3-(5,6-dihydrophenanthren-9-yl)-5-(4,6-dimethyl-1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]-2,4-diphenyl-1,2-dihydropyrrol-5-amine |
| SMILES | CC1=CC(C)NC(c2cc(-c3cc4ccccc4c4c3C=CCC4)cc([C@@]3(N)NC(c4ccccc4)C=C3c3ccccc3)c2)N1 |
| InChI | InChI=1S/C42H40N4/c1-27-21-28(2)45-41(44-27)33-22-32(38-25-31-17-9-10-18-35(31)36-19-11-12-20-37(36)38)23-34(24-33)42(43)39(29-13-5-3-6-14-29)26-40(46-42)30-15-7-4-8-16-30/h3-10,12-18,20-27,40-41,44-46H,11,19,43H2,1-2H3/t27?,40?,41?,42-/m1/s1 |
| InChIKey | MFMDJYXNJWRFAA-HCGMAJBXSA-N |
| XLogP | 8.49 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |