C39H34O4 — CID 145303263
ethane;3-methyl-6-[10-(4-phenyl-7,8-dihydronaphthalen-1-yl)anthracen-9-yl]benzene-1,2,4,5-tetrol (PubChem CID 145303263) has the molecular formula C39H34O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is ethane;3-methyl-6-[10-(4-phenyl-7,8-dihydronaphthalen-1-yl)anthracen-9-yl]benzene-1,2,4,5-tetrol.
| Compound Name | ethane;3-methyl-6-[10-(4-phenyl-7,8-dihydronaphthalen-1-yl)anthracen-9-yl]benzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 145303263 |
| Molecular Formula | C39H34O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | ethane;3-methyl-6-[10-(4-phenyl-7,8-dihydronaphthalen-1-yl)anthracen-9-yl]benzene-1,2,4,5-tetrol |
| SMILES | CC.Cc1c(O)c(O)c(-c2c3ccccc3c(-c3ccc(-c4ccccc4)c4c3CCC=C4)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C37H28O4.C2H6/c1-21-34(38)36(40)33(37(41)35(21)39)32-28-17-9-7-15-26(28)31(27-16-8-10-18-29(27)32)30-20-19-23(22-11-3-2-4-12-22)24-13-5-6-14-25(24)30;1-2/h2-5,7-13,15-20,38-41H,6,14H2,1H3;1-2H3 |
| InChIKey | NWSMAMAVOWVTMZ-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|