C48H36O3 — CID 145126470
3,4,6-trimethyl-5-[10-[4-(1-phenyl-6H-cyclohepta[b][1]benzofuran-2-yl)phenyl]anthracen-9-yl]benzene-1,2-diol (PubChem CID 145126470) has the molecular formula C48H36O3 and a molecular weight of 660.81 g/mol. Its IUPAC name is 3,4,6-trimethyl-5-[10-[4-(1-phenyl-6H-cyclohepta[b][1]benzofuran-2-yl)phenyl]anthracen-9-yl]benzene-1,2-diol.
| Compound Name | 3,4,6-trimethyl-5-[10-[4-(1-phenyl-6H-cyclohepta[b][1]benzofuran-2-yl)phenyl]anthracen-9-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 145126470 |
| Molecular Formula | C48H36O3 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | 3,4,6-trimethyl-5-[10-[4-(1-phenyl-6H-cyclohepta[b][1]benzofuran-2-yl)phenyl]anthracen-9-yl]benzene-1,2-diol |
| SMILES | Cc1c(C)c(-c2c3ccccc3c(-c3ccc(-c4ccc5oc6c(c5c4-c4ccccc4)C=CC=CC6)cc3)c3ccccc23)c(C)c(O)c1O |
| InChI | InChI=1S/C48H36O3/c1-28-29(2)47(49)48(50)30(3)42(28)45-37-18-12-10-16-35(37)43(36-17-11-13-19-38(36)45)33-24-22-31(23-25-33)34-26-27-41-46(44(34)32-14-6-4-7-15-32)39-20-8-5-9-21-40(39)51-41/h4-20,22-27,49-50H,21H2,1-3H3 |
| InChIKey | LMXZCJJJKIBSIE-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|