C42H41N3 — CID 167056617
6-cyclohexa-2,4-dien-1-yl-1-methyl-2-(2-methylspiro[1,2,4a,9a-tetrahydrofluorene-9,9'-1,2,7,8-tetrahydrofluorene]-2'-yl)-4-phenyl-2H-1,3,5-triazine (PubChem CID 167056617) has the molecular formula C42H41N3 and a molecular weight of 587.81 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-yl-1-methyl-2-(2-methylspiro[1,2,4a,9a-tetrahydrofluorene-9,9'-1,2,7,8-tetrahydrofluorene]-2'-yl)-4-phenyl-2H-1,3,5-triazine.
| Compound Name | 6-cyclohexa-2,4-dien-1-yl-1-methyl-2-(2-methylspiro[1,2,4a,9a-tetrahydrofluorene-9,9'-1,2,7,8-tetrahydrofluorene]-2'-yl)-4-phenyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 167056617 |
| Molecular Formula | C42H41N3 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-yl-1-methyl-2-(2-methylspiro[1,2,4a,9a-tetrahydrofluorene-9,9'-1,2,7,8-tetrahydrofluorene]-2'-yl)-4-phenyl-2H-1,3,5-triazine |
| SMILES | CC1C=CC2c3ccccc3C3(C4=C(C=CCC4)C4=C3CC(C3N=C(c5ccccc5)N=C(C5C=CC=CC5)N3C)C=C4)C2C1 |
| InChI | InChI=1S/C42H41N3/c1-27-21-23-33-31-17-9-11-19-35(31)42(37(33)25-27)36-20-12-10-18-32(36)34-24-22-30(26-38(34)42)41-44-39(28-13-5-3-6-14-28)43-40(45(41)2)29-15-7-4-8-16-29/h3-11,13-15,17-19,21-24,27,29-30,33,37,41H,12,16,20,25-26H2,1-2H3 |
| InChIKey | QOHQXPGYQVEIIQ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|