C46H42N2 — CID 167119193
(4S)-6-cyclohexa-1,3-dien-1-yl-2-[5-(4,5-diphenylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4-(4-phenylcyclohexa-2,4-dien-1-yl)-4,5-dihydropyrimidine (PubChem CID 167119193) has the molecular formula C46H42N2 and a molecular weight of 622.86 g/mol. Its IUPAC name is (4S)-6-cyclohexa-1,3-dien-1-yl-2-[5-(4,5-diphenylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4-(4-phenylcyclohexa-2,4-dien-1-yl)-4,5-dihydropyrimidine.
| Compound Name | (4S)-6-cyclohexa-1,3-dien-1-yl-2-[5-(4,5-diphenylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4-(4-phenylcyclohexa-2,4-dien-1-yl)-4,5-dihydropyrimidine |
|---|---|
| PubChem CID | 167119193 |
| Molecular Formula | C46H42N2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | (4S)-6-cyclohexa-1,3-dien-1-yl-2-[5-(4,5-diphenylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-dien-1-yl]-4-(4-phenylcyclohexa-2,4-dien-1-yl)-4,5-dihydropyrimidine |
| SMILES | C1=CCCC(C2=NC(C3=CC=CC(C4=CCC(c5ccccc5)C(c5ccccc5)=C4)C3)=N[C@H](C3C=CC(c4ccccc4)=CC3)C2)=C1 |
| InChI | InChI=1S/C46H42N2/c1-5-14-33(15-6-1)34-24-26-38(27-25-34)45-32-44(37-20-11-4-12-21-37)47-46(48-45)41-23-13-22-39(30-41)40-28-29-42(35-16-7-2-8-17-35)43(31-40)36-18-9-3-10-19-36/h1-11,13-20,22-26,28,31,38-39,42,45H,12,21,27,29-30,32H2/t38?,39?,42?,45-/m0/s1 |
| InChIKey | XMNIPZJYTSAQOT-RKHRPQPDSA-N |
| XLogP | 11.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |