C48H44N2 — CID 154937816
N-[4-(4-carbazol-9-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,5-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 154937816) has the molecular formula C48H44N2 and a molecular weight of 648.89 g/mol. Its IUPAC name is N-[4-(4-carbazol-9-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,5-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-amine.
| Compound Name | N-[4-(4-carbazol-9-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,5-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 154937816 |
| Molecular Formula | C48H44N2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | N-[4-(4-carbazol-9-ylcyclohexa-1,5-dien-1-yl)cyclohexa-1,5-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | C1=CCCC(C2=CC=C(N(C3=CCC(C4=CCC(n5c6ccccc6c6ccccc65)C=C4)C=C3)C3C=CC(c4ccccc4)=CC3)CC2)=C1 |
| InChI | InChI=1S/C48H44N2/c1-3-11-35(12-4-1)37-19-27-41(28-20-37)49(42-29-21-38(22-30-42)36-13-5-2-6-14-36)43-31-23-39(24-32-43)40-25-33-44(34-26-40)50-47-17-9-7-15-45(47)46-16-8-10-18-48(46)50/h1-5,7-13,15-21,23,25-27,29,31-33,39,41,44H,6,14,22,24,28,30,34H2 |
| InChIKey | YEWALERIAULBNS-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |