C46H42N2 — CID 166953660
4-[4-(3,4,4a,11b-tetrahydrobenzo[a]carbazol-11-yl)cyclohexa-1,5-dien-1-yl]-N-cyclohexa-1,5-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline (PubChem CID 166953660) has the molecular formula C46H42N2 and a molecular weight of 622.86 g/mol. Its IUPAC name is 4-[4-(3,4,4a,11b-tetrahydrobenzo[a]carbazol-11-yl)cyclohexa-1,5-dien-1-yl]-N-cyclohexa-1,5-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline.
| Compound Name | 4-[4-(3,4,4a,11b-tetrahydrobenzo[a]carbazol-11-yl)cyclohexa-1,5-dien-1-yl]-N-cyclohexa-1,5-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline |
|---|---|
| PubChem CID | 166953660 |
| Molecular Formula | C46H42N2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 4-[4-(3,4,4a,11b-tetrahydrobenzo[a]carbazol-11-yl)cyclohexa-1,5-dien-1-yl]-N-cyclohexa-1,5-dien-1-yl-N-(4-phenylcyclohexa-2,4-dien-1-yl)aniline |
| SMILES | C1=CC(N(c2ccc(C3=CCC(n4c5c(c6ccccc64)C=CC4CCC=CC54)C=C3)cc2)C2C=CC(c3ccccc3)=CC2)=CCC1 |
| InChI | InChI=1S/C46H42N2/c1-3-11-33(12-4-1)34-19-26-39(27-20-34)47(38-14-5-2-6-15-38)40-28-21-35(22-29-40)36-23-30-41(31-24-36)48-45-18-10-9-17-43(45)44-32-25-37-13-7-8-16-42(37)46(44)48/h1,3-5,8-12,14-26,28-30,32,37,39,41-42H,2,6-7,13,27,31H2 |
| InChIKey | QDTLHJUGRUWDHT-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|