C32H31N — CID 138493659
N-(3-cyclohexa-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)-4-cyclopenta-1,4-dien-1-yl-N-[(1S)-2-phenylcyclobut-2-en-1-yl]cyclohexa-1,5-dien-1-amine (PubChem CID 138493659) has the molecular formula C32H31N and a molecular weight of 429.61 g/mol. Its IUPAC name is N-(3-cyclohexa-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)-4-cyclopenta-1,4-dien-1-yl-N-[(1S)-2-phenylcyclobut-2-en-1-yl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-(3-cyclohexa-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)-4-cyclopenta-1,4-dien-1-yl-N-[(1S)-2-phenylcyclobut-2-en-1-yl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 138493659 |
| Molecular Formula | C32H31N |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-(3-cyclohexa-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)-4-cyclopenta-1,4-dien-1-yl-N-[(1S)-2-phenylcyclobut-2-en-1-yl]cyclohexa-1,5-dien-1-amine |
| SMILES | C1=CCCC(C2=CCC(N(C3=CCC(C4=CCC=C4)C=C3)[C@H]3CC=C3c3ccccc3)=C2)=C1 |
| InChI | InChI=1S/C32H31N/c1-3-9-25(10-4-1)28-17-20-30(23-28)33(32-22-21-31(32)27-13-5-2-6-14-27)29-18-15-26(16-19-29)24-11-7-8-12-24/h1-3,5-7,9,11-15,17-19,21,23,26,32H,4,8,10,16,20,22H2/t26?,32-/m0/s1 |
| InChIKey | FMOOSOUHCFSFJM-AKWYTYQQSA-N |
| XLogP | 7.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |