C17H15I — CID 163982380
2-cyclohexa-1,3-dien-1-yl-5-phenyl-1λ3-iodacyclohexa-1,3,5-triene (PubChem CID 163982380) has the molecular formula C17H15I and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-5-phenyl-1λ3-iodacyclohexa-1,3,5-triene.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-5-phenyl-1λ3-iodacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 163982380 |
| Molecular Formula | C17H15I |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-5-phenyl-1λ3-iodacyclohexa-1,3,5-triene |
| SMILES | C1=CCCC(C2=IC=C(c3ccccc3)C=C2)=C1 |
| InChI | InChI=1S/C17H15I/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15/h1-5,7-9,11-13H,6,10H2 |
| InChIKey | SZOAZNMBRNXYFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|