C28H28N4 — CID 170228215
4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethyl-2-pyridinyl)phenyl]-1,4-dihydro-1,3,5-triazine (PubChem CID 170228215) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethyl-2-pyridinyl)phenyl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethyl-2-pyridinyl)phenyl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 170228215 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethyl-2-pyridinyl)phenyl]-1,4-dihydro-1,3,5-triazine |
| SMILES | Cc1cc(C)nc(-c2ccc(C3=NC(C4=CC=CCC4)N=C(C4=CCCC=C4)N3)cc2)c1 |
| InChI | InChI=1S/C28H28N4/c1-19-17-20(2)29-25(18-19)21-13-15-24(16-14-21)28-31-26(22-9-5-3-6-10-22)30-27(32-28)23-11-7-4-8-12-23/h3,5,7,9,11-18,26H,4,6,8,10H2,1-2H3,(H,30,31,32) |
| InChIKey | SJVPQAODWQSGLC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |