C45H41N5 — CID 175623925
9-[2-[2-cyclohexa-1,5-dien-1-yl-6-[2-(1,2,7,8-tetrahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-1,4-dihydro-1,3,5-triazin-4-yl]cyclohexa-1,3-dien-1-yl]carbazole (PubChem CID 175623925) has the molecular formula C45H41N5 and a molecular weight of 651.86 g/mol. Its IUPAC name is 9-[2-[2-cyclohexa-1,5-dien-1-yl-6-[2-(1,2,7,8-tetrahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-1,4-dihydro-1,3,5-triazin-4-yl]cyclohexa-1,3-dien-1-yl]carbazole.
| Compound Name | 9-[2-[2-cyclohexa-1,5-dien-1-yl-6-[2-(1,2,7,8-tetrahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-1,4-dihydro-1,3,5-triazin-4-yl]cyclohexa-1,3-dien-1-yl]carbazole |
|---|---|
| PubChem CID | 175623925 |
| Molecular Formula | C45H41N5 |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 9-[2-[2-cyclohexa-1,5-dien-1-yl-6-[2-(1,2,7,8-tetrahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-1,4-dihydro-1,3,5-triazin-4-yl]cyclohexa-1,3-dien-1-yl]carbazole |
| SMILES | C1=CCC(C2=NC(C3=C(n4c5ccccc5c5ccccc54)CCC=C3)N=C(C3=CCCC=C3)N2)C(n2c3c(c4c2CCC=C4)C=CCC3)=C1 |
| InChI | InChI=1S/C45H41N5/c1-2-16-30(17-3-1)43-46-44(35-22-8-14-28-41(35)49-37-24-10-4-18-31(37)32-19-5-11-25-38(32)49)48-45(47-43)36-23-9-15-29-42(36)50-39-26-12-6-20-33(39)34-21-7-13-27-40(34)50/h2,4-11,15-22,24-25,29,36,44H,1,3,12-14,23,26-28H2,(H,46,47,48) |
| InChIKey | QTKGFAOPTWGTQJ-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |