C32H27N3 — CID 118203367
14,22-diphenyl-9,14,22-triazahexacyclo[11.10.0.02,10.03,8.015,23.016,21]tricosa-1(13),2(10),5,7,15(23),16(21),17-heptaene (PubChem CID 118203367) has the molecular formula C32H27N3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 14,22-diphenyl-9,14,22-triazahexacyclo[11.10.0.02,10.03,8.015,23.016,21]tricosa-1(13),2(10),5,7,15(23),16(21),17-heptaene.
| Compound Name | 14,22-diphenyl-9,14,22-triazahexacyclo[11.10.0.02,10.03,8.015,23.016,21]tricosa-1(13),2(10),5,7,15(23),16(21),17-heptaene |
|---|---|
| PubChem CID | 118203367 |
| Molecular Formula | C32H27N3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 14,22-diphenyl-9,14,22-triazahexacyclo[11.10.0.02,10.03,8.015,23.016,21]tricosa-1(13),2(10),5,7,15(23),16(21),17-heptaene |
| SMILES | C1=CCC2C(=C1)NC1=C2c2c(n(-c3ccccc3)c3c4c(n(-c5ccccc5)c23)CCC=C4)CC1 |
| InChI | InChI=1S/C32H27N3/c1-3-11-21(12-4-1)34-27-18-10-8-16-24(27)31-32(34)30-28(35(31)22-13-5-2-6-14-22)20-19-26-29(30)23-15-7-9-17-25(23)33-26/h1-9,11-14,16-17,23,33H,10,15,18-20H2 |
| InChIKey | UGWNOEAZYQTDDL-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 21.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |