C27H25N5 — CID 130184267
2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 130184267) has the molecular formula C27H25N5 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 130184267 |
| Molecular Formula | C27H25N5 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-6-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]-4-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | Cc1cc(C)nc(-c2ccc(C3=NC(c4ccccc4)N=C(C4=CCCC=C4)N3)cc2)n1 |
| InChI | InChI=1S/C27H25N5/c1-18-17-19(2)29-24(28-18)22-13-15-23(16-14-22)27-31-25(20-9-5-3-6-10-20)30-26(32-27)21-11-7-4-8-12-21/h3,5-7,9-17,25H,4,8H2,1-2H3,(H,30,31,32) |
| InChIKey | MQDIAEGJGQJJRS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |