C46H41N7 — CID 130184171
4-[3-[(2E,4Z)-6-(4,6-dimethylpyrimidin-2-yl)hepta-2,4,6-trien-3-yl]phenyl]-2-[3-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]-6-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 130184171) has the molecular formula C46H41N7 and a molecular weight of 691.88 g/mol. Its IUPAC name is 4-[3-[(2E,4Z)-6-(4,6-dimethylpyrimidin-2-yl)hepta-2,4,6-trien-3-yl]phenyl]-2-[3-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]-6-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[3-[(2E,4Z)-6-(4,6-dimethylpyrimidin-2-yl)hepta-2,4,6-trien-3-yl]phenyl]-2-[3-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]-6-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 130184171 |
| Molecular Formula | C46H41N7 |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 4-[3-[(2E,4Z)-6-(4,6-dimethylpyrimidin-2-yl)hepta-2,4,6-trien-3-yl]phenyl]-2-[3-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]-6-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C=C(/C=C\C(=C/C)c1cccc(C2N=C(c3ccccc3)NC(c3cccc(-c4ccc(-c5nc(C)cc(C)n5)cc4)c3)=N2)c1)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C46H41N7/c1-7-34(20-19-29(2)42-47-30(3)25-31(4)48-42)38-15-11-17-40(27-38)45-51-44(36-13-9-8-10-14-36)52-46(53-45)41-18-12-16-39(28-41)35-21-23-37(24-22-35)43-49-32(5)26-33(6)50-43/h7-28,45H,2H2,1,3-6H3,(H,51,52,53)/b20-19-,34-7+ |
| InChIKey | UYNKHPXHZXFCJC-QTDOKBMNSA-N |
| XLogP | 10.00 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|