C38H46N7P — CID 153394351
4-(4-cyclohexa-1,5-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)-N,N-dimethylaniline;[3-(4-cyclohexa-1,3-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)phenyl]-dimethylphosphane;ethane (PubChem CID 153394351) has the molecular formula C38H46N7P and a molecular weight of 631.81 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,5-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)-N,N-dimethylaniline;[3-(4-cyclohexa-1,3-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)phenyl]-dimethylphosphane;ethane.
| Compound Name | 4-(4-cyclohexa-1,5-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)-N,N-dimethylaniline;[3-(4-cyclohexa-1,3-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)phenyl]-dimethylphosphane;ethane |
|---|---|
| PubChem CID | 153394351 |
| Molecular Formula | C38H46N7P |
| Molecular Weight | 631.81 g/mol |
| Exact Mass | 631.36 |
| IUPAC Name | 4-(4-cyclohexa-1,5-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)-N,N-dimethylaniline;[3-(4-cyclohexa-1,3-dien-1-yl-6-methyl-1,3,5-triazin-2-yl)phenyl]-dimethylphosphane;ethane |
| SMILES | CC.Cc1nc(C2=CC=CCC2)nc(-c2cccc(P(C)C)c2)n1.Cc1nc(C2=CCCC=C2)nc(-c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C18H20N4.C18H20N3P.C2H6/c1-13-19-17(14-7-5-4-6-8-14)21-18(20-13)15-9-11-16(12-10-15)22(2)3;1-13-19-17(14-8-5-4-6-9-14)21-18(20-13)15-10-7-11-16(12-15)22(2)3;1-2/h5,7-12H,4,6H2,1-3H3;4-5,7-8,10-12H,6,9H2,1-3H3;1-2H3 |
| InChIKey | FBZQTWZIKMNTPJ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.81 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|