C14H27N3 — CID 146652081
2-[(2R)-1,4-ditert-butylpiperazin-2-yl]acetonitrile (PubChem CID 146652081) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-[(2R)-1,4-ditert-butylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2R)-1,4-ditert-butylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 146652081 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 2-[(2R)-1,4-ditert-butylpiperazin-2-yl]acetonitrile |
| SMILES | CC(C)(C)N1CCN(C(C)(C)C)[C@H](CC#N)C1 |
| InChI | InChI=1S/C14H27N3/c1-13(2,3)16-9-10-17(14(4,5)6)12(11-16)7-8-15/h12H,7,9-11H2,1-6H3/t12-/m1/s1 |
| InChIKey | NPUXOJFQQZMQRP-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |