C14H23N3O — CID 167292044
2-[1-tert-butyl-4-(2-oxobut-3-enyl)piperazin-2-yl]acetonitrile (PubChem CID 167292044) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[1-tert-butyl-4-(2-oxobut-3-enyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[1-tert-butyl-4-(2-oxobut-3-enyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167292044 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-[1-tert-butyl-4-(2-oxobut-3-enyl)piperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)CN1CCN(C(C)(C)C)C(CC#N)C1 |
| InChI | InChI=1S/C14H23N3O/c1-5-13(18)11-16-8-9-17(14(2,3)4)12(10-16)6-7-15/h5,12H,1,6,8-11H2,2-4H3 |
| InChIKey | MMVXGSXRAOTKJV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|