C10H18N2O2 — CID 162736698
1-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]but-3-en-2-one (PubChem CID 162736698) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]but-3-en-2-one.
| Compound Name | 1-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 162736698 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]but-3-en-2-one |
| SMILES | C=CC(=O)CN1CCN(C)C(CO)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-3-10(14)7-12-5-4-11(2)9(6-12)8-13/h3,9,13H,1,4-8H2,2H3 |
| InChIKey | ZWJGCYASFJSZNX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|