C14H22N2O — CID 155794380
2-(4-tert-butyl-1-prop-2-enoylpiperidin-2-yl)acetonitrile (PubChem CID 155794380) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-prop-2-enoylpiperidin-2-yl)acetonitrile.
| Compound Name | 2-(4-tert-butyl-1-prop-2-enoylpiperidin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 155794380 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-(4-tert-butyl-1-prop-2-enoylpiperidin-2-yl)acetonitrile |
| SMILES | C=CC(=O)N1CCC(C(C)(C)C)CC1CC#N |
| InChI | InChI=1S/C14H22N2O/c1-5-13(17)16-9-7-11(14(2,3)4)10-12(16)6-8-15/h5,11-12H,1,6-7,9-10H2,2-4H3 |
| InChIKey | YNITXTPGJHWKKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|