C12H21NOY-2 — CID 167352125
1-[(2S,4S)-4-tert-butyl-2-methanidylpiperidin-1-yl]ethanone;yttrium (PubChem CID 167352125) has the molecular formula C12H21NOY-2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 1-[(2S,4S)-4-tert-butyl-2-methanidylpiperidin-1-yl]ethanone;yttrium.
| Compound Name | 1-[(2S,4S)-4-tert-butyl-2-methanidylpiperidin-1-yl]ethanone;yttrium |
|---|---|
| PubChem CID | 167352125 |
| Molecular Formula | C12H21NOY-2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[(2S,4S)-4-tert-butyl-2-methanidylpiperidin-1-yl]ethanone;yttrium |
| SMILES | [CH2-]C(=O)N1CC[C@H](C(C)(C)C)C[C@@H]1[CH2-].[Y] |
| InChI | InChI=1S/C12H21NO.Y/c1-9-8-11(12(3,4)5)6-7-13(9)10(2)14;/h9,11H,1-2,6-8H2,3-5H3;/q-2;/t9-,11-;/m0./s1 |
| InChIKey | INAZVWABGCFZDZ-ROLPUNSJSA-N |
| XLogP | 2.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|