C11H22N2O3 — CID 58311600
methyl 4-tert-butyl-2-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 58311600) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 4-tert-butyl-2-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-tert-butyl-2-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58311600 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methyl 4-tert-butyl-2-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(C)(C)C)CC1CO |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)12-5-6-13(10(15)16-4)9(7-12)8-14/h9,14H,5-8H2,1-4H3 |
| InChIKey | HOIFBOHANUYTFJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |